About thiolan-3-ylthiourea
thiolan-3-ylthiourea (PubChem CID 103062728) has the molecular formula C5H10N2S2
and a molecular weight of 162.28 g/mol. Its IUPAC name is thiolan-3-ylthiourea.
Molecular Properties
| Compound Name | thiolan-3-ylthiourea |
| PubChem CID | 103062728 |
| Molecular Formula | C5H10N2S2 |
| Molecular Weight | 162.28 g/mol |
| Exact Mass | 162.03 |
| IUPAC Name | thiolan-3-ylthiourea |
| SMILES | NC(=S)NC1CCSC1 |
| InChI | InChI=1S/C5H10N2S2/c6-5(8)7-4-1-2-9-3-4/h4H,1-3H2,(H3,6,7,8) |
| InChIKey | VKWRGGBCKYJCQY-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.28 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze thiolan-3-ylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thiolan-3-ylthiourea?
The IUPAC name of thiolan-3-ylthiourea (CID 103062728) is thiolan-3-ylthiourea.
What is the SMILES notation for thiolan-3-ylthiourea?
The canonical SMILES for thiolan-3-ylthiourea is NC(=S)NC1CCSC1.
What is the InChIKey of thiolan-3-ylthiourea?
The InChIKey is VKWRGGBCKYJCQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2S2/c6-5(8)7-4-1-2-9-3-4/h4H,1-3H2,(H3,6,7,8).
What are the key properties of thiolan-3-ylthiourea?
thiolan-3-ylthiourea has a molecular weight of 162.28 g/mol, XLogP of 0.33, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for thiolan-3-ylthiourea is sourced from PubChem (CID 103062728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).