C13H13ClN2O2S2 — CID 103063698
2-[5-chloro-1-(thiolan-3-yl)benzimidazol-2-yl]sulfanylacetic acid (PubChem CID 103063698) has the molecular formula C13H13ClN2O2S2 and a molecular weight of 328.85 g/mol. Its IUPAC name is 2-[5-chloro-1-(thiolan-3-yl)benzimidazol-2-yl]sulfanylacetic acid.
| Compound Name | 2-[5-chloro-1-(thiolan-3-yl)benzimidazol-2-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 103063698 |
| Molecular Formula | C13H13ClN2O2S2 |
| Molecular Weight | 328.85 g/mol |
| Exact Mass | 328.01 |
| IUPAC Name | 2-[5-chloro-1-(thiolan-3-yl)benzimidazol-2-yl]sulfanylacetic acid |
| SMILES | O=C(O)CSc1nc2cc(Cl)ccc2n1C1CCSC1 |
| InChI | InChI=1S/C13H13ClN2O2S2/c14-8-1-2-11-10(5-8)15-13(20-7-12(17)18)16(11)9-3-4-19-6-9/h1-2,5,9H,3-4,6-7H2,(H,17,18) |
| InChIKey | TVOGENISEFFHDH-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.85 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |