C11H18N2O3S — CID 103064106
3-(thiolan-3-ylcarbamoylamino)cyclopentane-1-carboxylic acid (PubChem CID 103064106) has the molecular formula C11H18N2O3S and a molecular weight of 258.34 g/mol. Its IUPAC name is 3-(thiolan-3-ylcarbamoylamino)cyclopentane-1-carboxylic acid.
| Compound Name | 3-(thiolan-3-ylcarbamoylamino)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 103064106 |
| Molecular Formula | C11H18N2O3S |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 3-(thiolan-3-ylcarbamoylamino)cyclopentane-1-carboxylic acid |
| SMILES | O=C(NC1CCSC1)NC1CCC(C(=O)O)C1 |
| InChI | InChI=1S/C11H18N2O3S/c14-10(15)7-1-2-8(5-7)12-11(16)13-9-3-4-17-6-9/h7-9H,1-6H2,(H,14,15)(H2,12,13,16) |
| InChIKey | WWYDKMQNJSEANG-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |