C15H26N2O2S — CID 103065061
3-butan-2-yl-6-propan-2-yl-1-(thiolan-3-yl)piperazine-2,5-dione (PubChem CID 103065061) has the molecular formula C15H26N2O2S and a molecular weight of 298.45 g/mol. Its IUPAC name is 3-butan-2-yl-6-propan-2-yl-1-(thiolan-3-yl)piperazine-2,5-dione.
| Compound Name | 3-butan-2-yl-6-propan-2-yl-1-(thiolan-3-yl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 103065061 |
| Molecular Formula | C15H26N2O2S |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 3-butan-2-yl-6-propan-2-yl-1-(thiolan-3-yl)piperazine-2,5-dione |
| SMILES | CCC(C)C1NC(=O)C(C(C)C)N(C2CCSC2)C1=O |
| InChI | InChI=1S/C15H26N2O2S/c1-5-10(4)12-15(19)17(11-6-7-20-8-11)13(9(2)3)14(18)16-12/h9-13H,5-8H2,1-4H3,(H,16,18) |
| InChIKey | JRESLEGKSHYIDN-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |