About 3,3-dimethyl-1-(thiolan-3-yl)piperazine-2,5-dione
3,3-dimethyl-1-(thiolan-3-yl)piperazine-2,5-dione (PubChem CID 103065085) has the molecular formula C10H16N2O2S
and a molecular weight of 228.32 g/mol. Its IUPAC name is 3,3-dimethyl-1-(thiolan-3-yl)piperazine-2,5-dione.
Molecular Properties
| Compound Name | 3,3-dimethyl-1-(thiolan-3-yl)piperazine-2,5-dione |
| PubChem CID | 103065085 |
| Molecular Formula | C10H16N2O2S |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 3,3-dimethyl-1-(thiolan-3-yl)piperazine-2,5-dione |
| SMILES | CC1(C)NC(=O)CN(C2CCSC2)C1=O |
| InChI | InChI=1S/C10H16N2O2S/c1-10(2)9(14)12(5-8(13)11-10)7-3-4-15-6-7/h7H,3-6H2,1-2H3,(H,11,13) |
| InChIKey | IGLFVEIYDFYPLW-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,3-dimethyl-1-(thiolan-3-yl)piperazine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethyl-1-(thiolan-3-yl)piperazine-2,5-dione?
The IUPAC name of 3,3-dimethyl-1-(thiolan-3-yl)piperazine-2,5-dione (CID 103065085) is 3,3-dimethyl-1-(thiolan-3-yl)piperazine-2,5-dione.
What is the SMILES notation for 3,3-dimethyl-1-(thiolan-3-yl)piperazine-2,5-dione?
The canonical SMILES for 3,3-dimethyl-1-(thiolan-3-yl)piperazine-2,5-dione is CC1(C)NC(=O)CN(C2CCSC2)C1=O.
What is the InChIKey of 3,3-dimethyl-1-(thiolan-3-yl)piperazine-2,5-dione?
The InChIKey is IGLFVEIYDFYPLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O2S/c1-10(2)9(14)12(5-8(13)11-10)7-3-4-15-6-7/h7H,3-6H2,1-2H3,(H,11,13).
What are the key properties of 3,3-dimethyl-1-(thiolan-3-yl)piperazine-2,5-dione?
3,3-dimethyl-1-(thiolan-3-yl)piperazine-2,5-dione has a molecular weight of 228.32 g/mol, XLogP of 0.23, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethyl-1-(thiolan-3-yl)piperazine-2,5-dione is sourced from PubChem (CID 103065085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).