C6H11N5S — CID 103065144
3-N-(thiolan-3-yl)-1H-1,2,4-triazole-3,5-diamine (PubChem CID 103065144) has the molecular formula C6H11N5S and a molecular weight of 185.26 g/mol. Its IUPAC name is 3-N-(thiolan-3-yl)-1H-1,2,4-triazole-3,5-diamine.
| Compound Name | 3-N-(thiolan-3-yl)-1H-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 103065144 |
| Molecular Formula | C6H11N5S |
| Molecular Weight | 185.26 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | 3-N-(thiolan-3-yl)-1H-1,2,4-triazole-3,5-diamine |
| SMILES | Nc1nc(NC2CCSC2)n[nH]1 |
| InChI | InChI=1S/C6H11N5S/c7-5-9-6(11-10-5)8-4-1-2-12-3-4/h4H,1-3H2,(H4,7,8,9,10,11) |
| InChIKey | GPLCPKOIEJLTKV-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.26 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |