C6H10N4S2 — CID 103065145
5-N-(thiolan-3-yl)-1,2,4-thiadiazole-3,5-diamine (PubChem CID 103065145) has the molecular formula C6H10N4S2 and a molecular weight of 202.31 g/mol. Its IUPAC name is 5-N-(thiolan-3-yl)-1,2,4-thiadiazole-3,5-diamine.
| Compound Name | 5-N-(thiolan-3-yl)-1,2,4-thiadiazole-3,5-diamine |
|---|---|
| PubChem CID | 103065145 |
| Molecular Formula | C6H10N4S2 |
| Molecular Weight | 202.31 g/mol |
| Exact Mass | 202.03 |
| IUPAC Name | 5-N-(thiolan-3-yl)-1,2,4-thiadiazole-3,5-diamine |
| SMILES | Nc1nsc(NC2CCSC2)n1 |
| InChI | InChI=1S/C6H10N4S2/c7-5-9-6(12-10-5)8-4-1-2-11-3-4/h4H,1-3H2,(H3,7,8,9,10) |
| InChIKey | JDLVBXOIFHIXGK-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.31 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |