C14H20N2O3S — CID 103065550
4-(thiolan-3-yl)-2,4-diazaspiro[5.6]dodecane-1,3,5-trione (PubChem CID 103065550) has the molecular formula C14H20N2O3S and a molecular weight of 296.39 g/mol. Its IUPAC name is 4-(thiolan-3-yl)-2,4-diazaspiro[5.6]dodecane-1,3,5-trione.
| Compound Name | 4-(thiolan-3-yl)-2,4-diazaspiro[5.6]dodecane-1,3,5-trione |
|---|---|
| PubChem CID | 103065550 |
| Molecular Formula | C14H20N2O3S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 4-(thiolan-3-yl)-2,4-diazaspiro[5.6]dodecane-1,3,5-trione |
| SMILES | O=C1NC(=O)C2(CCCCCC2)C(=O)N1C1CCSC1 |
| InChI | InChI=1S/C14H20N2O3S/c17-11-14(6-3-1-2-4-7-14)12(18)16(13(19)15-11)10-5-8-20-9-10/h10H,1-9H2,(H,15,17,19) |
| InChIKey | VMSQPIFJYCXPDJ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|