C14H12BrClN2O2S — CID 103065579
5-(3-bromophenyl)-6-chloro-3-(thiolan-3-yl)-1H-pyrimidine-2,4-dione (PubChem CID 103065579) has the molecular formula C14H12BrClN2O2S and a molecular weight of 387.69 g/mol. Its IUPAC name is 5-(3-bromophenyl)-6-chloro-3-(thiolan-3-yl)-1H-pyrimidine-2,4-dione.
| Compound Name | 5-(3-bromophenyl)-6-chloro-3-(thiolan-3-yl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 103065579 |
| Molecular Formula | C14H12BrClN2O2S |
| Molecular Weight | 387.69 g/mol |
| Exact Mass | 385.95 |
| IUPAC Name | 5-(3-bromophenyl)-6-chloro-3-(thiolan-3-yl)-1H-pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(Cl)c(-c2cccc(Br)c2)c(=O)n1C1CCSC1 |
| InChI | InChI=1S/C14H12BrClN2O2S/c15-9-3-1-2-8(6-9)11-12(16)17-14(20)18(13(11)19)10-4-5-21-7-10/h1-3,6,10H,4-5,7H2,(H,17,20) |
| InChIKey | RXCISQSFSHDVHD-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.69 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |