About 4-[2-(chloromethyl)prop-2-enoxy]-1,2-dimethylcyclohexane
4-[2-(chloromethyl)prop-2-enoxy]-1,2-dimethylcyclohexane (PubChem CID 103066143) has the molecular formula C12H21ClO
and a molecular weight of 216.75 g/mol. Its IUPAC name is 4-[2-(chloromethyl)prop-2-enoxy]-1,2-dimethylcyclohexane.
Molecular Properties
| Compound Name | 4-[2-(chloromethyl)prop-2-enoxy]-1,2-dimethylcyclohexane |
| PubChem CID | 103066143 |
| Molecular Formula | C12H21ClO |
| Molecular Weight | 216.75 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 4-[2-(chloromethyl)prop-2-enoxy]-1,2-dimethylcyclohexane |
| SMILES | C=C(CCl)COC1CCC(C)C(C)C1 |
| InChI | InChI=1S/C12H21ClO/c1-9(7-13)8-14-12-5-4-10(2)11(3)6-12/h10-12H,1,4-8H2,2-3H3 |
| InChIKey | JYUTYEOIBPKVCW-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.75 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(chloromethyl)prop-2-enoxy]-1,2-dimethylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(chloromethyl)prop-2-enoxy]-1,2-dimethylcyclohexane?
The IUPAC name of 4-[2-(chloromethyl)prop-2-enoxy]-1,2-dimethylcyclohexane (CID 103066143) is 4-[2-(chloromethyl)prop-2-enoxy]-1,2-dimethylcyclohexane.
What is the SMILES notation for 4-[2-(chloromethyl)prop-2-enoxy]-1,2-dimethylcyclohexane?
The canonical SMILES for 4-[2-(chloromethyl)prop-2-enoxy]-1,2-dimethylcyclohexane is C=C(CCl)COC1CCC(C)C(C)C1.
What is the InChIKey of 4-[2-(chloromethyl)prop-2-enoxy]-1,2-dimethylcyclohexane?
The InChIKey is JYUTYEOIBPKVCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21ClO/c1-9(7-13)8-14-12-5-4-10(2)11(3)6-12/h10-12H,1,4-8H2,2-3H3.
What are the key properties of 4-[2-(chloromethyl)prop-2-enoxy]-1,2-dimethylcyclohexane?
4-[2-(chloromethyl)prop-2-enoxy]-1,2-dimethylcyclohexane has a molecular weight of 216.75 g/mol, XLogP of 3.62, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(chloromethyl)prop-2-enoxy]-1,2-dimethylcyclohexane is sourced from PubChem (CID 103066143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).