C15H21NO — CID 103066925
N-[2-[(2-ethylphenoxy)methyl]prop-2-enyl]cyclopropanamine (PubChem CID 103066925) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is N-[2-[(2-ethylphenoxy)methyl]prop-2-enyl]cyclopropanamine.
| Compound Name | N-[2-[(2-ethylphenoxy)methyl]prop-2-enyl]cyclopropanamine |
|---|---|
| PubChem CID | 103066925 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | N-[2-[(2-ethylphenoxy)methyl]prop-2-enyl]cyclopropanamine |
| SMILES | C=C(CNC1CC1)COc1ccccc1CC |
| InChI | InChI=1S/C15H21NO/c1-3-13-6-4-5-7-15(13)17-11-12(2)10-16-14-8-9-14/h4-7,14,16H,2-3,8-11H2,1H3 |
| InChIKey | VJKSNGKMDDDJSS-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|