About 4-[2-(chloromethyl)prop-2-enyl]-2,3-dimethylthiomorpholine
4-[2-(chloromethyl)prop-2-enyl]-2,3-dimethylthiomorpholine (PubChem CID 103067971) has the molecular formula C10H18ClNS
and a molecular weight of 219.78 g/mol. Its IUPAC name is 4-[2-(chloromethyl)prop-2-enyl]-2,3-dimethylthiomorpholine.
Molecular Properties
| Compound Name | 4-[2-(chloromethyl)prop-2-enyl]-2,3-dimethylthiomorpholine |
| PubChem CID | 103067971 |
| Molecular Formula | C10H18ClNS |
| Molecular Weight | 219.78 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 4-[2-(chloromethyl)prop-2-enyl]-2,3-dimethylthiomorpholine |
| SMILES | C=C(CCl)CN1CCSC(C)C1C |
| InChI | InChI=1S/C10H18ClNS/c1-8(6-11)7-12-4-5-13-10(3)9(12)2/h9-10H,1,4-7H2,2-3H3 |
| InChIKey | RWHUKQNUGPKQQJ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.78 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(chloromethyl)prop-2-enyl]-2,3-dimethylthiomorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(chloromethyl)prop-2-enyl]-2,3-dimethylthiomorpholine?
The IUPAC name of 4-[2-(chloromethyl)prop-2-enyl]-2,3-dimethylthiomorpholine (CID 103067971) is 4-[2-(chloromethyl)prop-2-enyl]-2,3-dimethylthiomorpholine.
What is the SMILES notation for 4-[2-(chloromethyl)prop-2-enyl]-2,3-dimethylthiomorpholine?
The canonical SMILES for 4-[2-(chloromethyl)prop-2-enyl]-2,3-dimethylthiomorpholine is C=C(CCl)CN1CCSC(C)C1C.
What is the InChIKey of 4-[2-(chloromethyl)prop-2-enyl]-2,3-dimethylthiomorpholine?
The InChIKey is RWHUKQNUGPKQQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18ClNS/c1-8(6-11)7-12-4-5-13-10(3)9(12)2/h9-10H,1,4-7H2,2-3H3.
What are the key properties of 4-[2-(chloromethyl)prop-2-enyl]-2,3-dimethylthiomorpholine?
4-[2-(chloromethyl)prop-2-enyl]-2,3-dimethylthiomorpholine has a molecular weight of 219.78 g/mol, XLogP of 2.61, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(chloromethyl)prop-2-enyl]-2,3-dimethylthiomorpholine is sourced from PubChem (CID 103067971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).