About 2-[(3,4-dichlorophenyl)sulfanylmethyl]-N-propan-2-ylprop-2-en-1-amine
2-[(3,4-dichlorophenyl)sulfanylmethyl]-N-propan-2-ylprop-2-en-1-amine (PubChem CID 103068640) has the molecular formula C13H17Cl2NS
and a molecular weight of 290.26 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenyl)sulfanylmethyl]-N-propan-2-ylprop-2-en-1-amine.
Molecular Properties
| Compound Name | 2-[(3,4-dichlorophenyl)sulfanylmethyl]-N-propan-2-ylprop-2-en-1-amine |
| PubChem CID | 103068640 |
| Molecular Formula | C13H17Cl2NS |
| Molecular Weight | 290.26 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | 2-[(3,4-dichlorophenyl)sulfanylmethyl]-N-propan-2-ylprop-2-en-1-amine |
| SMILES | C=C(CNC(C)C)CSc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H17Cl2NS/c1-9(2)16-7-10(3)8-17-11-4-5-12(14)13(15)6-11/h4-6,9,16H,3,7-8H2,1-2H3 |
| InChIKey | SCMLUMBLDUEOJM-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.26 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3,4-dichlorophenyl)sulfanylmethyl]-N-propan-2-ylprop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3,4-dichlorophenyl)sulfanylmethyl]-N-propan-2-ylprop-2-en-1-amine?
The IUPAC name of 2-[(3,4-dichlorophenyl)sulfanylmethyl]-N-propan-2-ylprop-2-en-1-amine (CID 103068640) is 2-[(3,4-dichlorophenyl)sulfanylmethyl]-N-propan-2-ylprop-2-en-1-amine.
What is the SMILES notation for 2-[(3,4-dichlorophenyl)sulfanylmethyl]-N-propan-2-ylprop-2-en-1-amine?
The canonical SMILES for 2-[(3,4-dichlorophenyl)sulfanylmethyl]-N-propan-2-ylprop-2-en-1-amine is C=C(CNC(C)C)CSc1ccc(Cl)c(Cl)c1.
What is the InChIKey of 2-[(3,4-dichlorophenyl)sulfanylmethyl]-N-propan-2-ylprop-2-en-1-amine?
The InChIKey is SCMLUMBLDUEOJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17Cl2NS/c1-9(2)16-7-10(3)8-17-11-4-5-12(14)13(15)6-11/h4-6,9,16H,3,7-8H2,1-2H3.
What are the key properties of 2-[(3,4-dichlorophenyl)sulfanylmethyl]-N-propan-2-ylprop-2-en-1-amine?
2-[(3,4-dichlorophenyl)sulfanylmethyl]-N-propan-2-ylprop-2-en-1-amine has a molecular weight of 290.26 g/mol, XLogP of 4.64, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,4-dichlorophenyl)sulfanylmethyl]-N-propan-2-ylprop-2-en-1-amine is sourced from PubChem (CID 103068640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).