About N'-methyl-2-methylidene-N'-(thiolan-3-yl)propane-1,3-diamine
N'-methyl-2-methylidene-N'-(thiolan-3-yl)propane-1,3-diamine (PubChem CID 103069322) has the molecular formula C9H18N2S
and a molecular weight of 186.32 g/mol. Its IUPAC name is N'-methyl-2-methylidene-N'-(thiolan-3-yl)propane-1,3-diamine.
Molecular Properties
| Compound Name | N'-methyl-2-methylidene-N'-(thiolan-3-yl)propane-1,3-diamine |
| PubChem CID | 103069322 |
| Molecular Formula | C9H18N2S |
| Molecular Weight | 186.32 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | N'-methyl-2-methylidene-N'-(thiolan-3-yl)propane-1,3-diamine |
| SMILES | C=C(CN)CN(C)C1CCSC1 |
| InChI | InChI=1S/C9H18N2S/c1-8(5-10)6-11(2)9-3-4-12-7-9/h9H,1,3-7,10H2,2H3 |
| InChIKey | NITQCFPQWBVFKN-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.32 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N'-methyl-2-methylidene-N'-(thiolan-3-yl)propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-methyl-2-methylidene-N'-(thiolan-3-yl)propane-1,3-diamine?
The IUPAC name of N'-methyl-2-methylidene-N'-(thiolan-3-yl)propane-1,3-diamine (CID 103069322) is N'-methyl-2-methylidene-N'-(thiolan-3-yl)propane-1,3-diamine.
What is the SMILES notation for N'-methyl-2-methylidene-N'-(thiolan-3-yl)propane-1,3-diamine?
The canonical SMILES for N'-methyl-2-methylidene-N'-(thiolan-3-yl)propane-1,3-diamine is C=C(CN)CN(C)C1CCSC1.
What is the InChIKey of N'-methyl-2-methylidene-N'-(thiolan-3-yl)propane-1,3-diamine?
The InChIKey is NITQCFPQWBVFKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2S/c1-8(5-10)6-11(2)9-3-4-12-7-9/h9H,1,3-7,10H2,2H3.
What are the key properties of N'-methyl-2-methylidene-N'-(thiolan-3-yl)propane-1,3-diamine?
N'-methyl-2-methylidene-N'-(thiolan-3-yl)propane-1,3-diamine has a molecular weight of 186.32 g/mol, XLogP of 0.94, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-methyl-2-methylidene-N'-(thiolan-3-yl)propane-1,3-diamine is sourced from PubChem (CID 103069322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).