C11H18N2S — CID 103069346
N,N'-dimethyl-2-methylidene-N'-(thiophen-2-ylmethyl)propane-1,3-diamine (PubChem CID 103069346) has the molecular formula C11H18N2S and a molecular weight of 210.35 g/mol. Its IUPAC name is N,N'-dimethyl-2-methylidene-N'-(thiophen-2-ylmethyl)propane-1,3-diamine.
| Compound Name | N,N'-dimethyl-2-methylidene-N'-(thiophen-2-ylmethyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 103069346 |
| Molecular Formula | C11H18N2S |
| Molecular Weight | 210.35 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | N,N'-dimethyl-2-methylidene-N'-(thiophen-2-ylmethyl)propane-1,3-diamine |
| SMILES | C=C(CNC)CN(C)Cc1cccs1 |
| InChI | InChI=1S/C11H18N2S/c1-10(7-12-2)8-13(3)9-11-5-4-6-14-11/h4-6,12H,1,7-9H2,2-3H3 |
| InChIKey | QCVNHVFDBRJSLI-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.35 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|