C13H24N2O — CID 103069466
N-cyclopropyl-N'-methyl-2-methylidene-N'-(oxan-4-yl)propane-1,3-diamine (PubChem CID 103069466) has the molecular formula C13H24N2O and a molecular weight of 224.35 g/mol. Its IUPAC name is N-cyclopropyl-N'-methyl-2-methylidene-N'-(oxan-4-yl)propane-1,3-diamine.
| Compound Name | N-cyclopropyl-N'-methyl-2-methylidene-N'-(oxan-4-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 103069466 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | N-cyclopropyl-N'-methyl-2-methylidene-N'-(oxan-4-yl)propane-1,3-diamine |
| SMILES | C=C(CNC1CC1)CN(C)C1CCOCC1 |
| InChI | InChI=1S/C13H24N2O/c1-11(9-14-12-3-4-12)10-15(2)13-5-7-16-8-6-13/h12-14H,1,3-10H2,2H3 |
| InChIKey | ZLZDKDWPFYYVOQ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|