About N-(1,1-dioxothiolan-3-yl)-N'-ethyl-N-methyl-2-methylidenepropane-1,3-diamine
N-(1,1-dioxothiolan-3-yl)-N'-ethyl-N-methyl-2-methylidenepropane-1,3-diamine (PubChem CID 103069492) has the molecular formula C11H22N2O2S
and a molecular weight of 246.38 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N'-ethyl-N-methyl-2-methylidenepropane-1,3-diamine.
Molecular Properties
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N'-ethyl-N-methyl-2-methylidenepropane-1,3-diamine |
| PubChem CID | 103069492 |
| Molecular Formula | C11H22N2O2S |
| Molecular Weight | 246.38 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N'-ethyl-N-methyl-2-methylidenepropane-1,3-diamine |
| SMILES | C=C(CNCC)CN(C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H22N2O2S/c1-4-12-7-10(2)8-13(3)11-5-6-16(14,15)9-11/h11-12H,2,4-9H2,1,3H3 |
| InChIKey | HBDJJMVJQFTEAZ-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.38 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(1,1-dioxothiolan-3-yl)-N'-ethyl-N-methyl-2-methylidenepropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,1-dioxothiolan-3-yl)-N'-ethyl-N-methyl-2-methylidenepropane-1,3-diamine?
The IUPAC name of N-(1,1-dioxothiolan-3-yl)-N'-ethyl-N-methyl-2-methylidenepropane-1,3-diamine (CID 103069492) is N-(1,1-dioxothiolan-3-yl)-N'-ethyl-N-methyl-2-methylidenepropane-1,3-diamine.
What is the SMILES notation for N-(1,1-dioxothiolan-3-yl)-N'-ethyl-N-methyl-2-methylidenepropane-1,3-diamine?
The canonical SMILES for N-(1,1-dioxothiolan-3-yl)-N'-ethyl-N-methyl-2-methylidenepropane-1,3-diamine is C=C(CNCC)CN(C)C1CCS(=O)(=O)C1.
What is the InChIKey of N-(1,1-dioxothiolan-3-yl)-N'-ethyl-N-methyl-2-methylidenepropane-1,3-diamine?
The InChIKey is HBDJJMVJQFTEAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O2S/c1-4-12-7-10(2)8-13(3)11-5-6-16(14,15)9-11/h11-12H,2,4-9H2,1,3H3.
What are the key properties of N-(1,1-dioxothiolan-3-yl)-N'-ethyl-N-methyl-2-methylidenepropane-1,3-diamine?
N-(1,1-dioxothiolan-3-yl)-N'-ethyl-N-methyl-2-methylidenepropane-1,3-diamine has a molecular weight of 246.38 g/mol, XLogP of 0.27, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,1-dioxothiolan-3-yl)-N'-ethyl-N-methyl-2-methylidenepropane-1,3-diamine is sourced from PubChem (CID 103069492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).