About N-(1,1-dioxothiolan-3-yl)-N-methyl-2-methylidene-N'-propylpropane-1,3-diamine
N-(1,1-dioxothiolan-3-yl)-N-methyl-2-methylidene-N'-propylpropane-1,3-diamine (PubChem CID 103069494) has the molecular formula C12H24N2O2S
and a molecular weight of 260.40 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N-methyl-2-methylidene-N'-propylpropane-1,3-diamine.
Molecular Properties
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N-methyl-2-methylidene-N'-propylpropane-1,3-diamine |
| PubChem CID | 103069494 |
| Molecular Formula | C12H24N2O2S |
| Molecular Weight | 260.40 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N-methyl-2-methylidene-N'-propylpropane-1,3-diamine |
| SMILES | C=C(CNCCC)CN(C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H24N2O2S/c1-4-6-13-8-11(2)9-14(3)12-5-7-17(15,16)10-12/h12-13H,2,4-10H2,1,3H3 |
| InChIKey | HHGHDSBPNJOJGK-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.40 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(1,1-dioxothiolan-3-yl)-N-methyl-2-methylidene-N'-propylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,1-dioxothiolan-3-yl)-N-methyl-2-methylidene-N'-propylpropane-1,3-diamine?
The IUPAC name of N-(1,1-dioxothiolan-3-yl)-N-methyl-2-methylidene-N'-propylpropane-1,3-diamine (CID 103069494) is N-(1,1-dioxothiolan-3-yl)-N-methyl-2-methylidene-N'-propylpropane-1,3-diamine.
What is the SMILES notation for N-(1,1-dioxothiolan-3-yl)-N-methyl-2-methylidene-N'-propylpropane-1,3-diamine?
The canonical SMILES for N-(1,1-dioxothiolan-3-yl)-N-methyl-2-methylidene-N'-propylpropane-1,3-diamine is C=C(CNCCC)CN(C)C1CCS(=O)(=O)C1.
What is the InChIKey of N-(1,1-dioxothiolan-3-yl)-N-methyl-2-methylidene-N'-propylpropane-1,3-diamine?
The InChIKey is HHGHDSBPNJOJGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O2S/c1-4-6-13-8-11(2)9-14(3)12-5-7-17(15,16)10-12/h12-13H,2,4-10H2,1,3H3.
What are the key properties of N-(1,1-dioxothiolan-3-yl)-N-methyl-2-methylidene-N'-propylpropane-1,3-diamine?
N-(1,1-dioxothiolan-3-yl)-N-methyl-2-methylidene-N'-propylpropane-1,3-diamine has a molecular weight of 260.40 g/mol, XLogP of 0.66, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,1-dioxothiolan-3-yl)-N-methyl-2-methylidene-N'-propylpropane-1,3-diamine is sourced from PubChem (CID 103069494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).