C13H26N2O — CID 103069737
N-ethyl-N'-methyl-2-methylidene-N'-(oxan-2-ylmethyl)propane-1,3-diamine (PubChem CID 103069737) has the molecular formula C13H26N2O and a molecular weight of 226.36 g/mol. Its IUPAC name is N-ethyl-N'-methyl-2-methylidene-N'-(oxan-2-ylmethyl)propane-1,3-diamine.
| Compound Name | N-ethyl-N'-methyl-2-methylidene-N'-(oxan-2-ylmethyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 103069737 |
| Molecular Formula | C13H26N2O |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.20 |
| IUPAC Name | N-ethyl-N'-methyl-2-methylidene-N'-(oxan-2-ylmethyl)propane-1,3-diamine |
| SMILES | C=C(CNCC)CN(C)CC1CCCCO1 |
| InChI | InChI=1S/C13H26N2O/c1-4-14-9-12(2)10-15(3)11-13-7-5-6-8-16-13/h13-14H,2,4-11H2,1,3H3 |
| InChIKey | OEOXDGDHOIHUFR-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|