C14H28N2O — CID 103069740
N-methyl-2-methylidene-N-(oxan-2-ylmethyl)-N'-propylpropane-1,3-diamine (PubChem CID 103069740) has the molecular formula C14H28N2O and a molecular weight of 240.39 g/mol. Its IUPAC name is N-methyl-2-methylidene-N-(oxan-2-ylmethyl)-N'-propylpropane-1,3-diamine.
| Compound Name | N-methyl-2-methylidene-N-(oxan-2-ylmethyl)-N'-propylpropane-1,3-diamine |
|---|---|
| PubChem CID | 103069740 |
| Molecular Formula | C14H28N2O |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.22 |
| IUPAC Name | N-methyl-2-methylidene-N-(oxan-2-ylmethyl)-N'-propylpropane-1,3-diamine |
| SMILES | C=C(CNCCC)CN(C)CC1CCCCO1 |
| InChI | InChI=1S/C14H28N2O/c1-4-8-15-10-13(2)11-16(3)12-14-7-5-6-9-17-14/h14-15H,2,4-12H2,1,3H3 |
| InChIKey | JCGMFUYMKXYXJQ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|