C14H30N2O — CID 103069826
2-[butyl-[2-[(tert-butylamino)methyl]prop-2-enyl]amino]ethanol (PubChem CID 103069826) has the molecular formula C14H30N2O and a molecular weight of 242.41 g/mol. Its IUPAC name is 2-[butyl-[2-[(tert-butylamino)methyl]prop-2-enyl]amino]ethanol.
| Compound Name | 2-[butyl-[2-[(tert-butylamino)methyl]prop-2-enyl]amino]ethanol |
|---|---|
| PubChem CID | 103069826 |
| Molecular Formula | C14H30N2O |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.24 |
| IUPAC Name | 2-[butyl-[2-[(tert-butylamino)methyl]prop-2-enyl]amino]ethanol |
| SMILES | C=C(CNC(C)(C)C)CN(CCO)CCCC |
| InChI | InChI=1S/C14H30N2O/c1-6-7-8-16(9-10-17)12-13(2)11-15-14(3,4)5/h15,17H,2,6-12H2,1,3-5H3 |
| InChIKey | XGDBISDXVQGDFO-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|