C14H22N2O — CID 103070217
N-ethyl-N'-(2-methoxyphenyl)-N'-methyl-2-methylidenepropane-1,3-diamine (PubChem CID 103070217) has the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. Its IUPAC name is N-ethyl-N'-(2-methoxyphenyl)-N'-methyl-2-methylidenepropane-1,3-diamine.
| Compound Name | N-ethyl-N'-(2-methoxyphenyl)-N'-methyl-2-methylidenepropane-1,3-diamine |
|---|---|
| PubChem CID | 103070217 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | N-ethyl-N'-(2-methoxyphenyl)-N'-methyl-2-methylidenepropane-1,3-diamine |
| SMILES | C=C(CNCC)CN(C)c1ccccc1OC |
| InChI | InChI=1S/C14H22N2O/c1-5-15-10-12(2)11-16(3)13-8-6-7-9-14(13)17-4/h6-9,15H,2,5,10-11H2,1,3-4H3 |
| InChIKey | GWROGVONGWHXHF-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|