C15H32N4 — CID 103070382
2-[[4-[2-(dimethylamino)ethyl]piperazin-1-yl]methyl]-N-propan-2-ylprop-2-en-1-amine (PubChem CID 103070382) has the molecular formula C15H32N4 and a molecular weight of 268.45 g/mol. Its IUPAC name is 2-[[4-[2-(dimethylamino)ethyl]piperazin-1-yl]methyl]-N-propan-2-ylprop-2-en-1-amine.
| Compound Name | 2-[[4-[2-(dimethylamino)ethyl]piperazin-1-yl]methyl]-N-propan-2-ylprop-2-en-1-amine |
|---|---|
| PubChem CID | 103070382 |
| Molecular Formula | C15H32N4 |
| Molecular Weight | 268.45 g/mol |
| Exact Mass | 268.26 |
| IUPAC Name | 2-[[4-[2-(dimethylamino)ethyl]piperazin-1-yl]methyl]-N-propan-2-ylprop-2-en-1-amine |
| SMILES | C=C(CNC(C)C)CN1CCN(CCN(C)C)CC1 |
| InChI | InChI=1S/C15H32N4/c1-14(2)16-12-15(3)13-19-10-8-18(9-11-19)7-6-17(4)5/h14,16H,3,6-13H2,1-2,4-5H3 |
| InChIKey | REGDLBAFMHZJAO-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 21.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.45 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|