C13H26N2S — CID 103070743
2-[(2,6-dimethylthiomorpholin-4-yl)methyl]-N-propylprop-2-en-1-amine (PubChem CID 103070743) has the molecular formula C13H26N2S and a molecular weight of 242.43 g/mol. Its IUPAC name is 2-[(2,6-dimethylthiomorpholin-4-yl)methyl]-N-propylprop-2-en-1-amine.
| Compound Name | 2-[(2,6-dimethylthiomorpholin-4-yl)methyl]-N-propylprop-2-en-1-amine |
|---|---|
| PubChem CID | 103070743 |
| Molecular Formula | C13H26N2S |
| Molecular Weight | 242.43 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 2-[(2,6-dimethylthiomorpholin-4-yl)methyl]-N-propylprop-2-en-1-amine |
| SMILES | C=C(CNCCC)CN1CC(C)SC(C)C1 |
| InChI | InChI=1S/C13H26N2S/c1-5-6-14-7-11(2)8-15-9-12(3)16-13(4)10-15/h12-14H,2,5-10H2,1,3-4H3 |
| InChIKey | HCJHNQVZQSXYQA-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.43 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|