C14H30N2 — CID 103070963
N-methyl-2-methylidene-N'-(2-methylpropyl)-N'-pentan-3-ylpropane-1,3-diamine (PubChem CID 103070963) has the molecular formula C14H30N2 and a molecular weight of 226.41 g/mol. Its IUPAC name is N-methyl-2-methylidene-N'-(2-methylpropyl)-N'-pentan-3-ylpropane-1,3-diamine.
| Compound Name | N-methyl-2-methylidene-N'-(2-methylpropyl)-N'-pentan-3-ylpropane-1,3-diamine |
|---|---|
| PubChem CID | 103070963 |
| Molecular Formula | C14H30N2 |
| Molecular Weight | 226.41 g/mol |
| Exact Mass | 226.24 |
| IUPAC Name | N-methyl-2-methylidene-N'-(2-methylpropyl)-N'-pentan-3-ylpropane-1,3-diamine |
| SMILES | C=C(CNC)CN(CC(C)C)C(CC)CC |
| InChI | InChI=1S/C14H30N2/c1-7-14(8-2)16(10-12(3)4)11-13(5)9-15-6/h12,14-15H,5,7-11H2,1-4,6H3 |
| InChIKey | QHGVPXWMMVSBPQ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|