C8H18N2S — CID 103071183
N'-methyl-2-methylidene-N'-(2-methylsulfanylethyl)propane-1,3-diamine (PubChem CID 103071183) has the molecular formula C8H18N2S and a molecular weight of 174.31 g/mol. Its IUPAC name is N'-methyl-2-methylidene-N'-(2-methylsulfanylethyl)propane-1,3-diamine.
| Compound Name | N'-methyl-2-methylidene-N'-(2-methylsulfanylethyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 103071183 |
| Molecular Formula | C8H18N2S |
| Molecular Weight | 174.31 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | N'-methyl-2-methylidene-N'-(2-methylsulfanylethyl)propane-1,3-diamine |
| SMILES | C=C(CN)CN(C)CCSC |
| InChI | InChI=1S/C8H18N2S/c1-8(6-9)7-10(2)4-5-11-3/h1,4-7,9H2,2-3H3 |
| InChIKey | PUTZMTUEQPTHNK-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.31 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|