C10H20N2S — CID 103071324
2-[(2,3-dimethylthiomorpholin-4-yl)methyl]prop-2-en-1-amine (PubChem CID 103071324) has the molecular formula C10H20N2S and a molecular weight of 200.35 g/mol. Its IUPAC name is 2-[(2,3-dimethylthiomorpholin-4-yl)methyl]prop-2-en-1-amine.
| Compound Name | 2-[(2,3-dimethylthiomorpholin-4-yl)methyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 103071324 |
| Molecular Formula | C10H20N2S |
| Molecular Weight | 200.35 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 2-[(2,3-dimethylthiomorpholin-4-yl)methyl]prop-2-en-1-amine |
| SMILES | C=C(CN)CN1CCSC(C)C1C |
| InChI | InChI=1S/C10H20N2S/c1-8(6-11)7-12-4-5-13-10(3)9(12)2/h9-10H,1,4-7,11H2,2-3H3 |
| InChIKey | VJSKFTDOXUONKK-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.35 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|