About 3-[2-(aminomethyl)prop-2-enyl]-4,5-dimethyl-1,3-thiazol-2-one
3-[2-(aminomethyl)prop-2-enyl]-4,5-dimethyl-1,3-thiazol-2-one (PubChem CID 103072422) has the molecular formula C9H14N2OS
and a molecular weight of 198.29 g/mol. Its IUPAC name is 3-[2-(aminomethyl)prop-2-enyl]-4,5-dimethyl-1,3-thiazol-2-one.
Molecular Properties
| Compound Name | 3-[2-(aminomethyl)prop-2-enyl]-4,5-dimethyl-1,3-thiazol-2-one |
| PubChem CID | 103072422 |
| Molecular Formula | C9H14N2OS |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 3-[2-(aminomethyl)prop-2-enyl]-4,5-dimethyl-1,3-thiazol-2-one |
| SMILES | C=C(CN)Cn1c(C)c(C)sc1=O |
| InChI | InChI=1S/C9H14N2OS/c1-6(4-10)5-11-7(2)8(3)13-9(11)12/h1,4-5,10H2,2-3H3 |
| InChIKey | ZHAMNWACRHSJBM-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(aminomethyl)prop-2-enyl]-4,5-dimethyl-1,3-thiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(aminomethyl)prop-2-enyl]-4,5-dimethyl-1,3-thiazol-2-one?
The IUPAC name of 3-[2-(aminomethyl)prop-2-enyl]-4,5-dimethyl-1,3-thiazol-2-one (CID 103072422) is 3-[2-(aminomethyl)prop-2-enyl]-4,5-dimethyl-1,3-thiazol-2-one.
What is the SMILES notation for 3-[2-(aminomethyl)prop-2-enyl]-4,5-dimethyl-1,3-thiazol-2-one?
The canonical SMILES for 3-[2-(aminomethyl)prop-2-enyl]-4,5-dimethyl-1,3-thiazol-2-one is C=C(CN)Cn1c(C)c(C)sc1=O.
What is the InChIKey of 3-[2-(aminomethyl)prop-2-enyl]-4,5-dimethyl-1,3-thiazol-2-one?
The InChIKey is ZHAMNWACRHSJBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2OS/c1-6(4-10)5-11-7(2)8(3)13-9(11)12/h1,4-5,10H2,2-3H3.
What are the key properties of 3-[2-(aminomethyl)prop-2-enyl]-4,5-dimethyl-1,3-thiazol-2-one?
3-[2-(aminomethyl)prop-2-enyl]-4,5-dimethyl-1,3-thiazol-2-one has a molecular weight of 198.29 g/mol, XLogP of 1.04, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(aminomethyl)prop-2-enyl]-4,5-dimethyl-1,3-thiazol-2-one is sourced from PubChem (CID 103072422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).