About 4,5-dimethyl-3-[2-(methylaminomethyl)prop-2-enyl]-1,3-thiazol-2-one
4,5-dimethyl-3-[2-(methylaminomethyl)prop-2-enyl]-1,3-thiazol-2-one (PubChem CID 103072424) has the molecular formula C10H16N2OS
and a molecular weight of 212.32 g/mol. Its IUPAC name is 4,5-dimethyl-3-[2-(methylaminomethyl)prop-2-enyl]-1,3-thiazol-2-one.
Molecular Properties
| Compound Name | 4,5-dimethyl-3-[2-(methylaminomethyl)prop-2-enyl]-1,3-thiazol-2-one |
| PubChem CID | 103072424 |
| Molecular Formula | C10H16N2OS |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 4,5-dimethyl-3-[2-(methylaminomethyl)prop-2-enyl]-1,3-thiazol-2-one |
| SMILES | C=C(CNC)Cn1c(C)c(C)sc1=O |
| InChI | InChI=1S/C10H16N2OS/c1-7(5-11-4)6-12-8(2)9(3)14-10(12)13/h11H,1,5-6H2,2-4H3 |
| InChIKey | SBBPBYVWYFRITD-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dimethyl-3-[2-(methylaminomethyl)prop-2-enyl]-1,3-thiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-3-[2-(methylaminomethyl)prop-2-enyl]-1,3-thiazol-2-one?
The IUPAC name of 4,5-dimethyl-3-[2-(methylaminomethyl)prop-2-enyl]-1,3-thiazol-2-one (CID 103072424) is 4,5-dimethyl-3-[2-(methylaminomethyl)prop-2-enyl]-1,3-thiazol-2-one.
What is the SMILES notation for 4,5-dimethyl-3-[2-(methylaminomethyl)prop-2-enyl]-1,3-thiazol-2-one?
The canonical SMILES for 4,5-dimethyl-3-[2-(methylaminomethyl)prop-2-enyl]-1,3-thiazol-2-one is C=C(CNC)Cn1c(C)c(C)sc1=O.
What is the InChIKey of 4,5-dimethyl-3-[2-(methylaminomethyl)prop-2-enyl]-1,3-thiazol-2-one?
The InChIKey is SBBPBYVWYFRITD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2OS/c1-7(5-11-4)6-12-8(2)9(3)14-10(12)13/h11H,1,5-6H2,2-4H3.
What are the key properties of 4,5-dimethyl-3-[2-(methylaminomethyl)prop-2-enyl]-1,3-thiazol-2-one?
4,5-dimethyl-3-[2-(methylaminomethyl)prop-2-enyl]-1,3-thiazol-2-one has a molecular weight of 212.32 g/mol, XLogP of 1.30, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-3-[2-(methylaminomethyl)prop-2-enyl]-1,3-thiazol-2-one is sourced from PubChem (CID 103072424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).