C11H19N3O — CID 103072797
1-[2-(methylaminomethyl)prop-2-enyl]-3-propan-2-ylimidazol-2-one (PubChem CID 103072797) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is 1-[2-(methylaminomethyl)prop-2-enyl]-3-propan-2-ylimidazol-2-one.
| Compound Name | 1-[2-(methylaminomethyl)prop-2-enyl]-3-propan-2-ylimidazol-2-one |
|---|---|
| PubChem CID | 103072797 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 1-[2-(methylaminomethyl)prop-2-enyl]-3-propan-2-ylimidazol-2-one |
| SMILES | C=C(CNC)Cn1ccn(C(C)C)c1=O |
| InChI | InChI=1S/C11H19N3O/c1-9(2)14-6-5-13(11(14)15)8-10(3)7-12-4/h5-6,9,12H,3,7-8H2,1-2,4H3 |
| InChIKey | DZUVZVWVZYYNMA-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 38.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|