C13H20N4O — CID 103073061
2-[2-(aminomethyl)prop-2-enyl]-5-piperidin-1-ylpyridazin-3-one (PubChem CID 103073061) has the molecular formula C13H20N4O and a molecular weight of 248.33 g/mol. Its IUPAC name is 2-[2-(aminomethyl)prop-2-enyl]-5-piperidin-1-ylpyridazin-3-one.
| Compound Name | 2-[2-(aminomethyl)prop-2-enyl]-5-piperidin-1-ylpyridazin-3-one |
|---|---|
| PubChem CID | 103073061 |
| Molecular Formula | C13H20N4O |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | 2-[2-(aminomethyl)prop-2-enyl]-5-piperidin-1-ylpyridazin-3-one |
| SMILES | C=C(CN)Cn1ncc(N2CCCCC2)cc1=O |
| InChI | InChI=1S/C13H20N4O/c1-11(8-14)10-17-13(18)7-12(9-15-17)16-5-3-2-4-6-16/h7,9H,1-6,8,10,14H2 |
| InChIKey | VWIKMDQOQQMXSU-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|