C14H24N4O2 — CID 103073071
2-[2-(ethylaminomethyl)prop-2-enyl]-5-[2-methoxyethyl(methyl)amino]pyridazin-3-one (PubChem CID 103073071) has the molecular formula C14H24N4O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is 2-[2-(ethylaminomethyl)prop-2-enyl]-5-[2-methoxyethyl(methyl)amino]pyridazin-3-one.
| Compound Name | 2-[2-(ethylaminomethyl)prop-2-enyl]-5-[2-methoxyethyl(methyl)amino]pyridazin-3-one |
|---|---|
| PubChem CID | 103073071 |
| Molecular Formula | C14H24N4O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | 2-[2-(ethylaminomethyl)prop-2-enyl]-5-[2-methoxyethyl(methyl)amino]pyridazin-3-one |
| SMILES | C=C(CNCC)Cn1ncc(N(C)CCOC)cc1=O |
| InChI | InChI=1S/C14H24N4O2/c1-5-15-9-12(2)11-18-14(19)8-13(10-16-18)17(3)6-7-20-4/h8,10,15H,2,5-7,9,11H2,1,3-4H3 |
| InChIKey | TVDGQVCVODRCEQ-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|