C15H26N4O2 — CID 103073073
5-[2-methoxyethyl(methyl)amino]-2-[2-(propylaminomethyl)prop-2-enyl]pyridazin-3-one (PubChem CID 103073073) has the molecular formula C15H26N4O2 and a molecular weight of 294.40 g/mol. Its IUPAC name is 5-[2-methoxyethyl(methyl)amino]-2-[2-(propylaminomethyl)prop-2-enyl]pyridazin-3-one.
| Compound Name | 5-[2-methoxyethyl(methyl)amino]-2-[2-(propylaminomethyl)prop-2-enyl]pyridazin-3-one |
|---|---|
| PubChem CID | 103073073 |
| Molecular Formula | C15H26N4O2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 5-[2-methoxyethyl(methyl)amino]-2-[2-(propylaminomethyl)prop-2-enyl]pyridazin-3-one |
| SMILES | C=C(CNCCC)Cn1ncc(N(C)CCOC)cc1=O |
| InChI | InChI=1S/C15H26N4O2/c1-5-6-16-10-13(2)12-19-15(20)9-14(11-17-19)18(3)7-8-21-4/h9,11,16H,2,5-8,10,12H2,1,3-4H3 |
| InChIKey | YRUPXGKTDDEUNQ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|