C14H24N4O — CID 103073079
5-[ethyl(methyl)amino]-2-[2-[(propan-2-ylamino)methyl]prop-2-enyl]pyridazin-3-one (PubChem CID 103073079) has the molecular formula C14H24N4O and a molecular weight of 264.37 g/mol. Its IUPAC name is 5-[ethyl(methyl)amino]-2-[2-[(propan-2-ylamino)methyl]prop-2-enyl]pyridazin-3-one.
| Compound Name | 5-[ethyl(methyl)amino]-2-[2-[(propan-2-ylamino)methyl]prop-2-enyl]pyridazin-3-one |
|---|---|
| PubChem CID | 103073079 |
| Molecular Formula | C14H24N4O |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.20 |
| IUPAC Name | 5-[ethyl(methyl)amino]-2-[2-[(propan-2-ylamino)methyl]prop-2-enyl]pyridazin-3-one |
| SMILES | C=C(CNC(C)C)Cn1ncc(N(C)CC)cc1=O |
| InChI | InChI=1S/C14H24N4O/c1-6-17(5)13-7-14(19)18(16-9-13)10-12(4)8-15-11(2)3/h7,9,11,15H,4,6,8,10H2,1-3,5H3 |
| InChIKey | GOIIVJGEPLDLLA-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|