C15H24N4O2 — CID 103073098
5-(2,2-dimethylmorpholin-4-yl)-2-[2-(methylaminomethyl)prop-2-enyl]pyridazin-3-one (PubChem CID 103073098) has the molecular formula C15H24N4O2 and a molecular weight of 292.38 g/mol. Its IUPAC name is 5-(2,2-dimethylmorpholin-4-yl)-2-[2-(methylaminomethyl)prop-2-enyl]pyridazin-3-one.
| Compound Name | 5-(2,2-dimethylmorpholin-4-yl)-2-[2-(methylaminomethyl)prop-2-enyl]pyridazin-3-one |
|---|---|
| PubChem CID | 103073098 |
| Molecular Formula | C15H24N4O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 5-(2,2-dimethylmorpholin-4-yl)-2-[2-(methylaminomethyl)prop-2-enyl]pyridazin-3-one |
| SMILES | C=C(CNC)Cn1ncc(N2CCOC(C)(C)C2)cc1=O |
| InChI | InChI=1S/C15H24N4O2/c1-12(8-16-4)10-19-14(20)7-13(9-17-19)18-5-6-21-15(2,3)11-18/h7,9,16H,1,5-6,8,10-11H2,2-4H3 |
| InChIKey | FUVDLBPEXIEUTJ-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|