C13H20N4O2 — CID 103073104
2-[2-(aminomethyl)prop-2-enyl]-5-(3-methoxypyrrolidin-1-yl)pyridazin-3-one (PubChem CID 103073104) has the molecular formula C13H20N4O2 and a molecular weight of 264.33 g/mol. Its IUPAC name is 2-[2-(aminomethyl)prop-2-enyl]-5-(3-methoxypyrrolidin-1-yl)pyridazin-3-one.
| Compound Name | 2-[2-(aminomethyl)prop-2-enyl]-5-(3-methoxypyrrolidin-1-yl)pyridazin-3-one |
|---|---|
| PubChem CID | 103073104 |
| Molecular Formula | C13H20N4O2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 2-[2-(aminomethyl)prop-2-enyl]-5-(3-methoxypyrrolidin-1-yl)pyridazin-3-one |
| SMILES | C=C(CN)Cn1ncc(N2CCC(OC)C2)cc1=O |
| InChI | InChI=1S/C13H20N4O2/c1-10(6-14)8-17-13(18)5-11(7-15-17)16-4-3-12(9-16)19-2/h5,7,12H,1,3-4,6,8-9,14H2,2H3 |
| InChIKey | KPKXOJQIWWFXHI-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|