C11H17N3O2 — CID 103073141
2-[2-(ethylaminomethyl)prop-2-enyl]-6-methoxypyridazin-3-one (PubChem CID 103073141) has the molecular formula C11H17N3O2 and a molecular weight of 223.28 g/mol. Its IUPAC name is 2-[2-(ethylaminomethyl)prop-2-enyl]-6-methoxypyridazin-3-one.
| Compound Name | 2-[2-(ethylaminomethyl)prop-2-enyl]-6-methoxypyridazin-3-one |
|---|---|
| PubChem CID | 103073141 |
| Molecular Formula | C11H17N3O2 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.13 |
| IUPAC Name | 2-[2-(ethylaminomethyl)prop-2-enyl]-6-methoxypyridazin-3-one |
| SMILES | C=C(CNCC)Cn1nc(OC)ccc1=O |
| InChI | InChI=1S/C11H17N3O2/c1-4-12-7-9(2)8-14-11(15)6-5-10(13-14)16-3/h5-6,12H,2,4,7-8H2,1,3H3 |
| InChIKey | TWXMZYLMAMTIQY-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|