C10H20N2S — CID 103073159
2-[(3,4-dimethylpiperazin-1-yl)methyl]prop-2-ene-1-thiol (PubChem CID 103073159) has the molecular formula C10H20N2S and a molecular weight of 200.35 g/mol. Its IUPAC name is 2-[(3,4-dimethylpiperazin-1-yl)methyl]prop-2-ene-1-thiol.
| Compound Name | 2-[(3,4-dimethylpiperazin-1-yl)methyl]prop-2-ene-1-thiol |
|---|---|
| PubChem CID | 103073159 |
| Molecular Formula | C10H20N2S |
| Molecular Weight | 200.35 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 2-[(3,4-dimethylpiperazin-1-yl)methyl]prop-2-ene-1-thiol |
| SMILES | C=C(CS)CN1CCN(C)C(C)C1 |
| InChI | InChI=1S/C10H20N2S/c1-9(8-13)6-12-5-4-11(3)10(2)7-12/h10,13H,1,4-8H2,2-3H3 |
| InChIKey | UYKNBYMMRCDEBV-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 6.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.35 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|