About 2-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]prop-2-ene-1-thiol
2-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]prop-2-ene-1-thiol (PubChem CID 103073297) has the molecular formula C8H15NO2S2
and a molecular weight of 221.35 g/mol. Its IUPAC name is 2-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]prop-2-ene-1-thiol.
Molecular Properties
| Compound Name | 2-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]prop-2-ene-1-thiol |
| PubChem CID | 103073297 |
| Molecular Formula | C8H15NO2S2 |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | 2-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]prop-2-ene-1-thiol |
| SMILES | C=C(CS)CN1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C8H15NO2S2/c1-8(7-12)6-9-2-4-13(10,11)5-3-9/h12H,1-7H2 |
| InChIKey | BLNCILORKVDXKX-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 37.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]prop-2-ene-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]prop-2-ene-1-thiol?
The IUPAC name of 2-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]prop-2-ene-1-thiol (CID 103073297) is 2-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]prop-2-ene-1-thiol.
What is the SMILES notation for 2-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]prop-2-ene-1-thiol?
The canonical SMILES for 2-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]prop-2-ene-1-thiol is C=C(CS)CN1CCS(=O)(=O)CC1.
What is the InChIKey of 2-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]prop-2-ene-1-thiol?
The InChIKey is BLNCILORKVDXKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO2S2/c1-8(7-12)6-9-2-4-13(10,11)5-3-9/h12H,1-7H2.
What are the key properties of 2-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]prop-2-ene-1-thiol?
2-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]prop-2-ene-1-thiol has a molecular weight of 221.35 g/mol, XLogP of 0.20, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]prop-2-ene-1-thiol is sourced from PubChem (CID 103073297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).