C10H17F3N2S — CID 103073341
2-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]prop-2-ene-1-thiol (PubChem CID 103073341) has the molecular formula C10H17F3N2S and a molecular weight of 254.32 g/mol. Its IUPAC name is 2-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]prop-2-ene-1-thiol.
| Compound Name | 2-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]prop-2-ene-1-thiol |
|---|---|
| PubChem CID | 103073341 |
| Molecular Formula | C10H17F3N2S |
| Molecular Weight | 254.32 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 2-[[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methyl]prop-2-ene-1-thiol |
| SMILES | C=C(CS)CN1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C10H17F3N2S/c1-9(7-16)6-14-2-4-15(5-3-14)8-10(11,12)13/h16H,1-8H2 |
| InChIKey | ZDNYRYUHLIXQDA-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 6.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.32 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|