C9H16F3NS — CID 103073352
2-[[propan-2-yl(2,2,2-trifluoroethyl)amino]methyl]prop-2-ene-1-thiol (PubChem CID 103073352) has the molecular formula C9H16F3NS and a molecular weight of 227.29 g/mol. Its IUPAC name is 2-[[propan-2-yl(2,2,2-trifluoroethyl)amino]methyl]prop-2-ene-1-thiol.
| Compound Name | 2-[[propan-2-yl(2,2,2-trifluoroethyl)amino]methyl]prop-2-ene-1-thiol |
|---|---|
| PubChem CID | 103073352 |
| Molecular Formula | C9H16F3NS |
| Molecular Weight | 227.29 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | 2-[[propan-2-yl(2,2,2-trifluoroethyl)amino]methyl]prop-2-ene-1-thiol |
| SMILES | C=C(CS)CN(CC(F)(F)F)C(C)C |
| InChI | InChI=1S/C9H16F3NS/c1-7(2)13(4-8(3)5-14)6-9(10,11)12/h7,14H,3-6H2,1-2H3 |
| InChIKey | AMVOVWRHHWYKTP-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.29 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|