C9H14F3NS — CID 103073355
2-[[cyclopropyl(2,2,2-trifluoroethyl)amino]methyl]prop-2-ene-1-thiol (PubChem CID 103073355) has the molecular formula C9H14F3NS and a molecular weight of 225.28 g/mol. Its IUPAC name is 2-[[cyclopropyl(2,2,2-trifluoroethyl)amino]methyl]prop-2-ene-1-thiol.
| Compound Name | 2-[[cyclopropyl(2,2,2-trifluoroethyl)amino]methyl]prop-2-ene-1-thiol |
|---|---|
| PubChem CID | 103073355 |
| Molecular Formula | C9H14F3NS |
| Molecular Weight | 225.28 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 2-[[cyclopropyl(2,2,2-trifluoroethyl)amino]methyl]prop-2-ene-1-thiol |
| SMILES | C=C(CS)CN(CC(F)(F)F)C1CC1 |
| InChI | InChI=1S/C9H14F3NS/c1-7(5-14)4-13(8-2-3-8)6-9(10,11)12/h8,14H,1-6H2 |
| InChIKey | XHRPYRCPDDTPHG-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.28 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|