About 2-[[cyclopropyl(2,2,2-trifluoroethyl)amino]methyl]prop-2-ene-1-thiol
2-[[cyclopropyl(2,2,2-trifluoroethyl)amino]methyl]prop-2-ene-1-thiol (PubChem CID 103073355) has the molecular formula C9H14F3NS
and a molecular weight of 225.28 g/mol. Its IUPAC name is 2-[[cyclopropyl(2,2,2-trifluoroethyl)amino]methyl]prop-2-ene-1-thiol.
Molecular Properties
| Compound Name | 2-[[cyclopropyl(2,2,2-trifluoroethyl)amino]methyl]prop-2-ene-1-thiol |
| PubChem CID | 103073355 |
| Molecular Formula | C9H14F3NS |
| Molecular Weight | 225.28 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 2-[[cyclopropyl(2,2,2-trifluoroethyl)amino]methyl]prop-2-ene-1-thiol |
| SMILES | C=C(CS)CN(CC(F)(F)F)C1CC1 |
| InChI | InChI=1S/C9H14F3NS/c1-7(5-14)4-13(8-2-3-8)6-9(10,11)12/h8,14H,1-6H2 |
| InChIKey | XHRPYRCPDDTPHG-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.28 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[[cyclopropyl(2,2,2-trifluoroethyl)amino]methyl]prop-2-ene-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[cyclopropyl(2,2,2-trifluoroethyl)amino]methyl]prop-2-ene-1-thiol?
The IUPAC name of 2-[[cyclopropyl(2,2,2-trifluoroethyl)amino]methyl]prop-2-ene-1-thiol (CID 103073355) is 2-[[cyclopropyl(2,2,2-trifluoroethyl)amino]methyl]prop-2-ene-1-thiol.
What is the SMILES notation for 2-[[cyclopropyl(2,2,2-trifluoroethyl)amino]methyl]prop-2-ene-1-thiol?
The canonical SMILES for 2-[[cyclopropyl(2,2,2-trifluoroethyl)amino]methyl]prop-2-ene-1-thiol is C=C(CS)CN(CC(F)(F)F)C1CC1.
What is the InChIKey of 2-[[cyclopropyl(2,2,2-trifluoroethyl)amino]methyl]prop-2-ene-1-thiol?
The InChIKey is XHRPYRCPDDTPHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14F3NS/c1-7(5-14)4-13(8-2-3-8)6-9(10,11)12/h8,14H,1-6H2.
What are the key properties of 2-[[cyclopropyl(2,2,2-trifluoroethyl)amino]methyl]prop-2-ene-1-thiol?
2-[[cyclopropyl(2,2,2-trifluoroethyl)amino]methyl]prop-2-ene-1-thiol has a molecular weight of 225.28 g/mol, XLogP of 2.50, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[cyclopropyl(2,2,2-trifluoroethyl)amino]methyl]prop-2-ene-1-thiol is sourced from PubChem (CID 103073355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).