C10H18F3NO — CID 103074345
N-tert-butyl-2-(2,2,2-trifluoroethoxymethyl)prop-2-en-1-amine (PubChem CID 103074345) has the molecular formula C10H18F3NO and a molecular weight of 225.25 g/mol. Its IUPAC name is N-tert-butyl-2-(2,2,2-trifluoroethoxymethyl)prop-2-en-1-amine.
| Compound Name | N-tert-butyl-2-(2,2,2-trifluoroethoxymethyl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 103074345 |
| Molecular Formula | C10H18F3NO |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | N-tert-butyl-2-(2,2,2-trifluoroethoxymethyl)prop-2-en-1-amine |
| SMILES | C=C(CNC(C)(C)C)COCC(F)(F)F |
| InChI | InChI=1S/C10H18F3NO/c1-8(5-14-9(2,3)4)6-15-7-10(11,12)13/h14H,1,5-7H2,2-4H3 |
| InChIKey | TXACXFRYVHZZEC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|