C12H25NO — CID 103074530
N-tert-butyl-2-[(2-methylpropan-2-yl)oxymethyl]prop-2-en-1-amine (PubChem CID 103074530) has the molecular formula C12H25NO and a molecular weight of 199.34 g/mol. Its IUPAC name is N-tert-butyl-2-[(2-methylpropan-2-yl)oxymethyl]prop-2-en-1-amine.
| Compound Name | N-tert-butyl-2-[(2-methylpropan-2-yl)oxymethyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 103074530 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | N-tert-butyl-2-[(2-methylpropan-2-yl)oxymethyl]prop-2-en-1-amine |
| SMILES | C=C(CNC(C)(C)C)COC(C)(C)C |
| InChI | InChI=1S/C12H25NO/c1-10(8-13-11(2,3)4)9-14-12(5,6)7/h13H,1,8-9H2,2-7H3 |
| InChIKey | XDKWOFJDUBDDAY-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|