C7H10F5NO — CID 103074934
2-(2,2,3,3,3-pentafluoropropoxymethyl)prop-2-en-1-amine (PubChem CID 103074934) has the molecular formula C7H10F5NO and a molecular weight of 219.15 g/mol. Its IUPAC name is 2-(2,2,3,3,3-pentafluoropropoxymethyl)prop-2-en-1-amine.
| Compound Name | 2-(2,2,3,3,3-pentafluoropropoxymethyl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 103074934 |
| Molecular Formula | C7H10F5NO |
| Molecular Weight | 219.15 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | 2-(2,2,3,3,3-pentafluoropropoxymethyl)prop-2-en-1-amine |
| SMILES | C=C(CN)COCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H10F5NO/c1-5(2-13)3-14-4-6(8,9)7(10,11)12/h1-4,13H2 |
| InChIKey | RPVZZIWWQHYPPX-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.15 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|