C15H22N4O — CID 103074978
2-methyl-3-[(1-phenyl-1,2,4-triazol-3-yl)oxy]-N-propylpropan-1-amine (PubChem CID 103074978) has the molecular formula C15H22N4O and a molecular weight of 274.37 g/mol. Its IUPAC name is 2-methyl-3-[(1-phenyl-1,2,4-triazol-3-yl)oxy]-N-propylpropan-1-amine.
| Compound Name | 2-methyl-3-[(1-phenyl-1,2,4-triazol-3-yl)oxy]-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 103074978 |
| Molecular Formula | C15H22N4O |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | 2-methyl-3-[(1-phenyl-1,2,4-triazol-3-yl)oxy]-N-propylpropan-1-amine |
| SMILES | CCCNCC(C)COc1ncn(-c2ccccc2)n1 |
| InChI | InChI=1S/C15H22N4O/c1-3-9-16-10-13(2)11-20-15-17-12-19(18-15)14-7-5-4-6-8-14/h4-8,12-13,16H,3,9-11H2,1-2H3 |
| InChIKey | NTWFVUIHVZMYOH-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|