C7H15F2NO — CID 103075035
3-(2,2-difluoroethoxy)-N,2-dimethylpropan-1-amine (PubChem CID 103075035) has the molecular formula C7H15F2NO and a molecular weight of 167.20 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-N,2-dimethylpropan-1-amine.
| Compound Name | 3-(2,2-difluoroethoxy)-N,2-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 103075035 |
| Molecular Formula | C7H15F2NO |
| Molecular Weight | 167.20 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-N,2-dimethylpropan-1-amine |
| SMILES | CNCC(C)COCC(F)F |
| InChI | InChI=1S/C7H15F2NO/c1-6(3-10-2)4-11-5-7(8)9/h6-7,10H,3-5H2,1-2H3 |
| InChIKey | LYOUCQQUJUMTJJ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.20 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |