C14H27NO2 — CID 103075082
2-[(2,6-dimethyloxan-4-yl)oxymethyl]-N-propan-2-ylprop-2-en-1-amine (PubChem CID 103075082) has the molecular formula C14H27NO2 and a molecular weight of 241.37 g/mol. Its IUPAC name is 2-[(2,6-dimethyloxan-4-yl)oxymethyl]-N-propan-2-ylprop-2-en-1-amine.
| Compound Name | 2-[(2,6-dimethyloxan-4-yl)oxymethyl]-N-propan-2-ylprop-2-en-1-amine |
|---|---|
| PubChem CID | 103075082 |
| Molecular Formula | C14H27NO2 |
| Molecular Weight | 241.37 g/mol |
| Exact Mass | 241.20 |
| IUPAC Name | 2-[(2,6-dimethyloxan-4-yl)oxymethyl]-N-propan-2-ylprop-2-en-1-amine |
| SMILES | C=C(CNC(C)C)COC1CC(C)OC(C)C1 |
| InChI | InChI=1S/C14H27NO2/c1-10(2)15-8-11(3)9-16-14-6-12(4)17-13(5)7-14/h10,12-15H,3,6-9H2,1-2,4-5H3 |
| InChIKey | KTOFPONHZPCABJ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|