C12H23NO2 — CID 103075085
2-[(2,6-dimethyloxan-4-yl)oxymethyl]-N-methylprop-2-en-1-amine (PubChem CID 103075085) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is 2-[(2,6-dimethyloxan-4-yl)oxymethyl]-N-methylprop-2-en-1-amine.
| Compound Name | 2-[(2,6-dimethyloxan-4-yl)oxymethyl]-N-methylprop-2-en-1-amine |
|---|---|
| PubChem CID | 103075085 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | 2-[(2,6-dimethyloxan-4-yl)oxymethyl]-N-methylprop-2-en-1-amine |
| SMILES | C=C(CNC)COC1CC(C)OC(C)C1 |
| InChI | InChI=1S/C12H23NO2/c1-9(7-13-4)8-14-12-5-10(2)15-11(3)6-12/h10-13H,1,5-8H2,2-4H3 |
| InChIKey | QWBPSUBMDJYWQX-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|