C8H11F6NO — CID 103075214
2-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)-N-methylprop-2-en-1-amine (PubChem CID 103075214) has the molecular formula C8H11F6NO and a molecular weight of 251.17 g/mol. Its IUPAC name is 2-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)-N-methylprop-2-en-1-amine.
| Compound Name | 2-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)-N-methylprop-2-en-1-amine |
|---|---|
| PubChem CID | 103075214 |
| Molecular Formula | C8H11F6NO |
| Molecular Weight | 251.17 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 2-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)-N-methylprop-2-en-1-amine |
| SMILES | C=C(CNC)COC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H11F6NO/c1-5(3-15-2)4-16-6(7(9,10)11)8(12,13)14/h6,15H,1,3-4H2,2H3 |
| InChIKey | JRAWPPCRXXLLBW-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.17 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|